About CID 10531066
CID 10531066 (PubChem CID 10531066) has the molecular formula C30H24N4O4S2
and a molecular weight of 568.68 g/mol.
Molecular Properties
| Compound Name | CID 10531066 |
| PubChem CID | 10531066 |
| Molecular Formula | C30H24N4O4S2 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | — |
| SMILES | O=S(=O)(c1ccccc1)c1ccc2c(c1)=NC1(CCC3(CC1)N=c1ccc(S(=O)(=O)c4ccccc4)cc1=N3)N=2 |
| InChI | InChI=1S/C30H24N4O4S2/c35-39(36,21-7-3-1-4-8-21)23-11-13-25-27(19-23)33-29(31-25)15-17-30(18-16-29)32-26-14-12-24(20-28(26)34-30)40(37,38)22-9-5-2-6-10-22/h1-14,19-20H,15-18H2 |
| InChIKey | JRSREDQHDAPHKR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 10531066 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10531066?
The IUPAC name of CID 10531066 (CID 10531066) is not available.
What is the SMILES notation for CID 10531066?
The canonical SMILES for CID 10531066 is O=S(=O)(c1ccccc1)c1ccc2c(c1)=NC1(CCC3(CC1)N=c1ccc(S(=O)(=O)c4ccccc4)cc1=N3)N=2.
What is the InChIKey of CID 10531066?
The InChIKey is JRSREDQHDAPHKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24N4O4S2/c35-39(36,21-7-3-1-4-8-21)23-11-13-25-27(19-23)33-29(31-25)15-17-30(18-16-29)32-26-14-12-24(20-28(26)34-30)40(37,38)22-9-5-2-6-10-22/h1-14,19-20H,15-18H2.
What are the key properties of CID 10531066?
CID 10531066 has a molecular weight of 568.68 g/mol, XLogP of 2.52, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10531066 is sourced from PubChem (CID 10531066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).