C17H18Cl2N2 — CID 105310708
[1-(2,6-dichlorophenyl)-2-(2,3-dihydro-1H-inden-5-yl)ethyl]hydrazine (PubChem CID 105310708) has the molecular formula C17H18Cl2N2 and a molecular weight of 321.25 g/mol. Its IUPAC name is [1-(2,6-dichlorophenyl)-2-(2,3-dihydro-1H-inden-5-yl)ethyl]hydrazine.
| Compound Name | [1-(2,6-dichlorophenyl)-2-(2,3-dihydro-1H-inden-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105310708 |
| Molecular Formula | C17H18Cl2N2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [1-(2,6-dichlorophenyl)-2-(2,3-dihydro-1H-inden-5-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc2c(c1)CCC2)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H18Cl2N2/c18-14-5-2-6-15(19)17(14)16(21-20)10-11-7-8-12-3-1-4-13(12)9-11/h2,5-9,16,21H,1,3-4,10,20H2 |
| InChIKey | DDGHTEGIGGVOJU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|