C28H56N8O4 — CID 10531072
1-N,4-N,7-N,10-N-tetrabutyl-1,4,7,10-tetrazacyclododecane-1,4,7,10-tetracarboxamide (PubChem CID 10531072) has the molecular formula C28H56N8O4 and a molecular weight of 568.81 g/mol. Its IUPAC name is 1-N,4-N,7-N,10-N-tetrabutyl-1,4,7,10-tetrazacyclododecane-1,4,7,10-tetracarboxamide.
| Compound Name | 1-N,4-N,7-N,10-N-tetrabutyl-1,4,7,10-tetrazacyclododecane-1,4,7,10-tetracarboxamide |
|---|---|
| PubChem CID | 10531072 |
| Molecular Formula | C28H56N8O4 |
| Molecular Weight | 568.81 g/mol |
| Exact Mass | 568.44 |
| IUPAC Name | 1-N,4-N,7-N,10-N-tetrabutyl-1,4,7,10-tetrazacyclododecane-1,4,7,10-tetracarboxamide |
| SMILES | CCCCNC(=O)N1CCN(C(=O)NCCCC)CCN(C(=O)NCCCC)CCN(C(=O)NCCCC)CC1 |
| InChI | InChI=1S/C28H56N8O4/c1-5-9-13-29-25(37)33-17-19-34(26(38)30-14-10-6-2)21-23-36(28(40)32-16-12-8-4)24-22-35(20-18-33)27(39)31-15-11-7-3/h5-24H2,1-4H3,(H,29,37)(H,30,38)(H,31,39)(H,32,40) |
| InChIKey | MJYDMYANXVIGPN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.81 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|