C12H22N2O2S2 — CID 105310812
[4-ethylsulfonyl-1-(3-ethylthiophen-2-yl)butyl]hydrazine (PubChem CID 105310812) has the molecular formula C12H22N2O2S2 and a molecular weight of 290.45 g/mol. Its IUPAC name is [4-ethylsulfonyl-1-(3-ethylthiophen-2-yl)butyl]hydrazine.
| Compound Name | [4-ethylsulfonyl-1-(3-ethylthiophen-2-yl)butyl]hydrazine |
|---|---|
| PubChem CID | 105310812 |
| Molecular Formula | C12H22N2O2S2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | [4-ethylsulfonyl-1-(3-ethylthiophen-2-yl)butyl]hydrazine |
| SMILES | CCc1ccsc1C(CCCS(=O)(=O)CC)NN |
| InChI | InChI=1S/C12H22N2O2S2/c1-3-10-7-8-17-12(10)11(14-13)6-5-9-18(15,16)4-2/h7-8,11,14H,3-6,9,13H2,1-2H3 |
| InChIKey | MJZNQSDTSKSOLN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|