C29H31ClN2O6S — CID 10531121
4-[2-(2-tert-butyl-4,6-diphenylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate (PubChem CID 10531121) has the molecular formula C29H31ClN2O6S and a molecular weight of 571.10 g/mol. Its IUPAC name is 4-[2-(2-tert-butyl-4,6-diphenylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate.
| Compound Name | 4-[2-(2-tert-butyl-4,6-diphenylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate |
|---|---|
| PubChem CID | 10531121 |
| Molecular Formula | C29H31ClN2O6S |
| Molecular Weight | 571.10 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | 4-[2-(2-tert-butyl-4,6-diphenylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)cc(-c2ccccc2)[n+]1CCc1ccc(S(N)(=O)=O)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C29H31N2O2S.ClHO4/c1-29(2,3)28-21-25(23-10-6-4-7-11-23)20-27(24-12-8-5-9-13-24)31(28)19-18-22-14-16-26(17-15-22)34(30,32)33;2-1(3,4)5/h4-17,20-21H,18-19H2,1-3H3,(H2,30,32,33);(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | VSDSGLDTMZOJEY-UHFFFAOYSA-M |
| XLogP | 0.74 |
| TPSA | 156.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.10 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|