C14H30N2 — CID 105311247
8,10,10-trimethylundec-1-en-6-ylhydrazine (PubChem CID 105311247) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 8,10,10-trimethylundec-1-en-6-ylhydrazine.
| Compound Name | 8,10,10-trimethylundec-1-en-6-ylhydrazine |
|---|---|
| PubChem CID | 105311247 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 8,10,10-trimethylundec-1-en-6-ylhydrazine |
| SMILES | C=CCCCC(CC(C)CC(C)(C)C)NN |
| InChI | InChI=1S/C14H30N2/c1-6-7-8-9-13(16-15)10-12(2)11-14(3,4)5/h6,12-13,16H,1,7-11,15H2,2-5H3 |
| InChIKey | AULOKJPIKLVJPN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|