About zinc bis([(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane)
zinc bis([(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane) (PubChem CID 10531151) has the molecular formula C30H58O2Si2Zn
and a molecular weight of 572.35 g/mol. Its IUPAC name is zinc bis([(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane).
Molecular Properties
| Compound Name | zinc bis([(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane) |
| PubChem CID | 10531151 |
| Molecular Formula | C30H58O2Si2Zn |
| Molecular Weight | 572.35 g/mol |
| Exact Mass | 570.33 |
| IUPAC Name | zinc bis([(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane) |
| SMILES | [H]/[C-]=C\C=C\CCO[Si](C(C)C)(C(C)C)C(C)C.[H]/[C-]=C\C=C\CCO[Si](C(C)C)(C(C)C)C(C)C.[Zn+2] |
| InChI | InChI=1S/2C15H29OSi.Zn/c2*1-8-9-10-11-12-16-17(13(2)3,14(4)5)15(6)7;/h2*1,8-10,13-15H,11-12H2,2-7H3;/q2*-1;+2/b2*10-9+; |
| InChIKey | CMJIRYAPSLSZDH-JGMJEEPBSA-N |
| XLogP | 10.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.35 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze zinc bis([(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis([(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane)?
The IUPAC name of zinc bis([(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane) (CID 10531151) is zinc bis([(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane).
What is the SMILES notation for zinc bis([(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane)?
The canonical SMILES for zinc bis([(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane) is [H]/[C-]=C\C=C\CCO[Si](C(C)C)(C(C)C)C(C)C.[H]/[C-]=C\C=C\CCO[Si](C(C)C)(C(C)C)C(C)C.[Zn+2].
What is the InChIKey of zinc bis([(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane)?
The InChIKey is CMJIRYAPSLSZDH-JGMJEEPBSA-N. The full InChI is InChI=1S/2C15H29OSi.Zn/c2*1-8-9-10-11-12-16-17(13(2)3,14(4)5)15(6)7;/h2*1,8-10,13-15H,11-12H2,2-7H3;/q2*-1;+2/b2*10-9+;.
What are the key properties of zinc bis([(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane)?
zinc bis([(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane) has a molecular weight of 572.35 g/mol, XLogP of 10.23, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis([(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane) is sourced from PubChem (CID 10531151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).