C15H30OSi — CID 10531152
[(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane (PubChem CID 10531152) has the molecular formula C15H30OSi and a molecular weight of 254.49 g/mol. Its IUPAC name is [(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane.
| Compound Name | [(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10531152 |
| Molecular Formula | C15H30OSi |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | [(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane |
| SMILES | C=C/C=C/CCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C15H30OSi/c1-8-9-10-11-12-16-17(13(2)3,14(4)5)15(6)7/h8-10,13-15H,1,11-12H2,2-7H3/b10-9+ |
| InChIKey | OPCRIPDLEFDFQM-MDZDMXLPSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|