About [(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane
[(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane (PubChem CID 10531152) has the molecular formula C15H30OSi
and a molecular weight of 254.49 g/mol. Its IUPAC name is [(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane |
| PubChem CID | 10531152 |
| Molecular Formula | C15H30OSi |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | [(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane |
| SMILES | C=C/C=C/CCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C15H30OSi/c1-8-9-10-11-12-16-17(13(2)3,14(4)5)15(6)7/h8-10,13-15H,1,11-12H2,2-7H3/b10-9+ |
| InChIKey | OPCRIPDLEFDFQM-MDZDMXLPSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane?
The IUPAC name of [(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane (CID 10531152) is [(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane.
What is the SMILES notation for [(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane?
The canonical SMILES for [(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane is C=C/C=C/CCO[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of [(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane?
The InChIKey is OPCRIPDLEFDFQM-MDZDMXLPSA-N. The full InChI is InChI=1S/C15H30OSi/c1-8-9-10-11-12-16-17(13(2)3,14(4)5)15(6)7/h8-10,13-15H,1,11-12H2,2-7H3/b10-9+.
What are the key properties of [(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane?
[(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane has a molecular weight of 254.49 g/mol, XLogP of 5.31, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E)-hexa-3,5-dienoxy]-tri(propan-2-yl)silane is sourced from PubChem (CID 10531152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).