C31H50O4SSi2 — CID 10531215
S-tert-butyl (3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-phenyl-4-phenylmethoxy-3-trimethylsilyloxypentanethioate (PubChem CID 10531215) has the molecular formula C31H50O4SSi2 and a molecular weight of 574.98 g/mol. Its IUPAC name is S-tert-butyl (3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-phenyl-4-phenylmethoxy-3-trimethylsilyloxypentanethioate.
| Compound Name | S-tert-butyl (3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-phenyl-4-phenylmethoxy-3-trimethylsilyloxypentanethioate |
|---|---|
| PubChem CID | 10531215 |
| Molecular Formula | C31H50O4SSi2 |
| Molecular Weight | 574.98 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | S-tert-butyl (3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-phenyl-4-phenylmethoxy-3-trimethylsilyloxypentanethioate |
| SMILES | CC(C)(C)SC(=O)C[C@@H](O[Si](C)(C)C)[C@H](OCc1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C31H50O4SSi2/c1-30(2,3)36-27(32)22-26(34-37(7,8)9)29(33-23-24-18-14-12-15-19-24)28(25-20-16-13-17-21-25)35-38(10,11)31(4,5)6/h12-21,26,28-29H,22-23H2,1-11H3/t26-,28-,29+/m1/s1 |
| InChIKey | FUHFROPPPXYAAR-CMYDWJSCSA-N |
| XLogP | 9.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.98 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|