C26H48O8SSi2 — CID 10531255
(3R,4S,5S)-2-(benzenesulfonylmethyl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(dimethoxymethyl)oxolan-2-ol (PubChem CID 10531255) has the molecular formula C26H48O8SSi2 and a molecular weight of 576.90 g/mol. Its IUPAC name is (3R,4S,5S)-2-(benzenesulfonylmethyl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(dimethoxymethyl)oxolan-2-ol.
| Compound Name | (3R,4S,5S)-2-(benzenesulfonylmethyl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(dimethoxymethyl)oxolan-2-ol |
|---|---|
| PubChem CID | 10531255 |
| Molecular Formula | C26H48O8SSi2 |
| Molecular Weight | 576.90 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | (3R,4S,5S)-2-(benzenesulfonylmethyl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(dimethoxymethyl)oxolan-2-ol |
| SMILES | COC(OC)[C@H]1OC(O)(CS(=O)(=O)c2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H48O8SSi2/c1-24(2,3)36(9,10)33-20-21(23(30-7)31-8)32-26(27,22(20)34-37(11,12)25(4,5)6)18-35(28,29)19-16-14-13-15-17-19/h13-17,20-23,27H,18H2,1-12H3/t20-,21-,22+,26?/m0/s1 |
| InChIKey | CIFMHNVHKVXHRV-JJYZUEOJSA-N |
| XLogP | 4.95 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.90 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|