C18H20N2S — CID 105312893
[1-benzothiophen-2-yl-(2,4,5-trimethylphenyl)methyl]hydrazine (PubChem CID 105312893) has the molecular formula C18H20N2S and a molecular weight of 296.44 g/mol. Its IUPAC name is [1-benzothiophen-2-yl-(2,4,5-trimethylphenyl)methyl]hydrazine.
| Compound Name | [1-benzothiophen-2-yl-(2,4,5-trimethylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105312893 |
| Molecular Formula | C18H20N2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | [1-benzothiophen-2-yl-(2,4,5-trimethylphenyl)methyl]hydrazine |
| SMILES | Cc1cc(C)c(C(NN)c2cc3ccccc3s2)cc1C |
| InChI | InChI=1S/C18H20N2S/c1-11-8-13(3)15(9-12(11)2)18(20-19)17-10-14-6-4-5-7-16(14)21-17/h4-10,18,20H,19H2,1-3H3 |
| InChIKey | ZVKQJCXXUQPQBB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|