C19H26N2 — CID 105312925
[2-phenyl-1-(2,4,5-trimethylphenyl)butyl]hydrazine (PubChem CID 105312925) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is [2-phenyl-1-(2,4,5-trimethylphenyl)butyl]hydrazine.
| Compound Name | [2-phenyl-1-(2,4,5-trimethylphenyl)butyl]hydrazine |
|---|---|
| PubChem CID | 105312925 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | [2-phenyl-1-(2,4,5-trimethylphenyl)butyl]hydrazine |
| SMILES | CCC(c1ccccc1)C(NN)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C19H26N2/c1-5-17(16-9-7-6-8-10-16)19(21-20)18-12-14(3)13(2)11-15(18)4/h6-12,17,19,21H,5,20H2,1-4H3 |
| InChIKey | HGJLZPDYBSMWMW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|