C14H24N2S — CID 105313487
[(5-ethylthiophen-2-yl)-(3-methylcyclohexyl)methyl]hydrazine (PubChem CID 105313487) has the molecular formula C14H24N2S and a molecular weight of 252.43 g/mol. Its IUPAC name is [(5-ethylthiophen-2-yl)-(3-methylcyclohexyl)methyl]hydrazine.
| Compound Name | [(5-ethylthiophen-2-yl)-(3-methylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105313487 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | [(5-ethylthiophen-2-yl)-(3-methylcyclohexyl)methyl]hydrazine |
| SMILES | CCc1ccc(C(NN)C2CCCC(C)C2)s1 |
| InChI | InChI=1S/C14H24N2S/c1-3-12-7-8-13(17-12)14(16-15)11-6-4-5-10(2)9-11/h7-8,10-11,14,16H,3-6,9,15H2,1-2H3 |
| InChIKey | FBDAFDYCSBXGQH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|