About (2-cyclopropyl-6,6,6-trifluorohexan-3-yl)hydrazine
(2-cyclopropyl-6,6,6-trifluorohexan-3-yl)hydrazine (PubChem CID 105313858) has the molecular formula C9H17F3N2
and a molecular weight of 210.24 g/mol. Its IUPAC name is (2-cyclopropyl-6,6,6-trifluorohexan-3-yl)hydrazine.
Molecular Properties
| Compound Name | (2-cyclopropyl-6,6,6-trifluorohexan-3-yl)hydrazine |
| PubChem CID | 105313858 |
| Molecular Formula | C9H17F3N2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (2-cyclopropyl-6,6,6-trifluorohexan-3-yl)hydrazine |
| SMILES | CC(C1CC1)C(CCC(F)(F)F)NN |
| InChI | InChI=1S/C9H17F3N2/c1-6(7-2-3-7)8(14-13)4-5-9(10,11)12/h6-8,14H,2-5,13H2,1H3 |
| InChIKey | UDZLKEKVHBQDJL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-cyclopropyl-6,6,6-trifluorohexan-3-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclopropyl-6,6,6-trifluorohexan-3-yl)hydrazine?
The IUPAC name of (2-cyclopropyl-6,6,6-trifluorohexan-3-yl)hydrazine (CID 105313858) is (2-cyclopropyl-6,6,6-trifluorohexan-3-yl)hydrazine.
What is the SMILES notation for (2-cyclopropyl-6,6,6-trifluorohexan-3-yl)hydrazine?
The canonical SMILES for (2-cyclopropyl-6,6,6-trifluorohexan-3-yl)hydrazine is CC(C1CC1)C(CCC(F)(F)F)NN.
What is the InChIKey of (2-cyclopropyl-6,6,6-trifluorohexan-3-yl)hydrazine?
The InChIKey is UDZLKEKVHBQDJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2/c1-6(7-2-3-7)8(14-13)4-5-9(10,11)12/h6-8,14H,2-5,13H2,1H3.
What are the key properties of (2-cyclopropyl-6,6,6-trifluorohexan-3-yl)hydrazine?
(2-cyclopropyl-6,6,6-trifluorohexan-3-yl)hydrazine has a molecular weight of 210.24 g/mol, XLogP of 2.21, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclopropyl-6,6,6-trifluorohexan-3-yl)hydrazine is sourced from PubChem (CID 105313858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).