C11H21F3N2O — CID 105313962
[4,4,4-trifluoro-1-(2,4,5-trimethyloxolan-3-yl)butyl]hydrazine (PubChem CID 105313962) has the molecular formula C11H21F3N2O and a molecular weight of 254.30 g/mol. Its IUPAC name is [4,4,4-trifluoro-1-(2,4,5-trimethyloxolan-3-yl)butyl]hydrazine.
| Compound Name | [4,4,4-trifluoro-1-(2,4,5-trimethyloxolan-3-yl)butyl]hydrazine |
|---|---|
| PubChem CID | 105313962 |
| Molecular Formula | C11H21F3N2O |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | [4,4,4-trifluoro-1-(2,4,5-trimethyloxolan-3-yl)butyl]hydrazine |
| SMILES | CC1OC(C)C(C(CCC(F)(F)F)NN)C1C |
| InChI | InChI=1S/C11H21F3N2O/c1-6-7(2)17-8(3)10(6)9(16-15)4-5-11(12,13)14/h6-10,16H,4-5,15H2,1-3H3 |
| InChIKey | AGVAJYIPPBLMPN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|