C11H23F3N2 — CID 105313990
(1,1,1-trifluoro-6,7,7-trimethyloctan-4-yl)hydrazine (PubChem CID 105313990) has the molecular formula C11H23F3N2 and a molecular weight of 240.31 g/mol. Its IUPAC name is (1,1,1-trifluoro-6,7,7-trimethyloctan-4-yl)hydrazine.
| Compound Name | (1,1,1-trifluoro-6,7,7-trimethyloctan-4-yl)hydrazine |
|---|---|
| PubChem CID | 105313990 |
| Molecular Formula | C11H23F3N2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | (1,1,1-trifluoro-6,7,7-trimethyloctan-4-yl)hydrazine |
| SMILES | CC(CC(CCC(F)(F)F)NN)C(C)(C)C |
| InChI | InChI=1S/C11H23F3N2/c1-8(10(2,3)4)7-9(16-15)5-6-11(12,13)14/h8-9,16H,5-7,15H2,1-4H3 |
| InChIKey | OFZGIPVHQLYFSB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|