C14H19BrN4S — CID 105314459
[1-(5-bromothiophen-3-yl)-2-(1-cyclopentylpyrazol-3-yl)ethyl]hydrazine (PubChem CID 105314459) has the molecular formula C14H19BrN4S and a molecular weight of 355.31 g/mol. Its IUPAC name is [1-(5-bromothiophen-3-yl)-2-(1-cyclopentylpyrazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(5-bromothiophen-3-yl)-2-(1-cyclopentylpyrazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105314459 |
| Molecular Formula | C14H19BrN4S |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | [1-(5-bromothiophen-3-yl)-2-(1-cyclopentylpyrazol-3-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccn(C2CCCC2)n1)c1csc(Br)c1 |
| InChI | InChI=1S/C14H19BrN4S/c15-14-7-10(9-20-14)13(17-16)8-11-5-6-19(18-11)12-3-1-2-4-12/h5-7,9,12-13,17H,1-4,8,16H2 |
| InChIKey | YHLMXRLMNNRSKK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|