C14H18Cl2N4 — CID 105315986
[2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-(3-chloro-4-methylphenyl)ethyl]hydrazine (PubChem CID 105315986) has the molecular formula C14H18Cl2N4 and a molecular weight of 313.23 g/mol. Its IUPAC name is [2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-(3-chloro-4-methylphenyl)ethyl]hydrazine.
| Compound Name | [2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-(3-chloro-4-methylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105315986 |
| Molecular Formula | C14H18Cl2N4 |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | [2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-(3-chloro-4-methylphenyl)ethyl]hydrazine |
| SMILES | Cc1ccc(C(Cc2c(Cl)c(C)nn2C)NN)cc1Cl |
| InChI | InChI=1S/C14H18Cl2N4/c1-8-4-5-10(6-11(8)15)12(18-17)7-13-14(16)9(2)19-20(13)3/h4-6,12,18H,7,17H2,1-3H3 |
| InChIKey | DPXBRQXDLOOZQF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|