C41H36F2N2O — CID 10531800
(4S,5S)-4,5-bis[(1S)-1-fluoro-2-phenylethyl]-1,3-bis(naphthalen-2-ylmethyl)imidazolidin-2-one (PubChem CID 10531800) has the molecular formula C41H36F2N2O and a molecular weight of 610.75 g/mol. Its IUPAC name is (4S,5S)-4,5-bis[(1S)-1-fluoro-2-phenylethyl]-1,3-bis(naphthalen-2-ylmethyl)imidazolidin-2-one.
| Compound Name | (4S,5S)-4,5-bis[(1S)-1-fluoro-2-phenylethyl]-1,3-bis(naphthalen-2-ylmethyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 10531800 |
| Molecular Formula | C41H36F2N2O |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | (4S,5S)-4,5-bis[(1S)-1-fluoro-2-phenylethyl]-1,3-bis(naphthalen-2-ylmethyl)imidazolidin-2-one |
| SMILES | O=C1N(Cc2ccc3ccccc3c2)[C@H]([C@@H](F)Cc2ccccc2)[C@@H]([C@@H](F)Cc2ccccc2)N1Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C41H36F2N2O/c42-37(25-29-11-3-1-4-12-29)39-40(38(43)26-30-13-5-2-6-14-30)45(28-32-20-22-34-16-8-10-18-36(34)24-32)41(46)44(39)27-31-19-21-33-15-7-9-17-35(33)23-31/h1-24,37-40H,25-28H2/t37-,38-,39+,40+/m0/s1 |
| InChIKey | XIKLAXVAYRGSBC-JPYDVTDNSA-N |
| XLogP | 9.33 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |