C37H39N7O2 — CID 10531840
N-[3-[3-[(6,9-dimethylphenazine-1-carbonyl)amino]propyl-methylamino]propyl]-6,9-dimethylphenazine-1-carboxamide (PubChem CID 10531840) has the molecular formula C37H39N7O2 and a molecular weight of 613.77 g/mol. Its IUPAC name is N-[3-[3-[(6,9-dimethylphenazine-1-carbonyl)amino]propyl-methylamino]propyl]-6,9-dimethylphenazine-1-carboxamide.
| Compound Name | N-[3-[3-[(6,9-dimethylphenazine-1-carbonyl)amino]propyl-methylamino]propyl]-6,9-dimethylphenazine-1-carboxamide |
|---|---|
| PubChem CID | 10531840 |
| Molecular Formula | C37H39N7O2 |
| Molecular Weight | 613.77 g/mol |
| Exact Mass | 613.32 |
| IUPAC Name | N-[3-[3-[(6,9-dimethylphenazine-1-carbonyl)amino]propyl-methylamino]propyl]-6,9-dimethylphenazine-1-carboxamide |
| SMILES | Cc1ccc(C)c2nc3c(C(=O)NCCCN(C)CCCNC(=O)c4cccc5nc6c(C)ccc(C)c6nc45)cccc3nc12 |
| InChI | InChI=1S/C37H39N7O2/c1-22-14-16-24(3)32-30(22)40-28-12-6-10-26(34(28)42-32)36(45)38-18-8-20-44(5)21-9-19-39-37(46)27-11-7-13-29-35(27)43-33-25(4)17-15-23(2)31(33)41-29/h6-7,10-17H,8-9,18-21H2,1-5H3,(H,38,45)(H,39,46) |
| InChIKey | ZLTPHPGWMBLRMS-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.77 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|