C16H18F15N2O4P — CID 10531889
4-[morpholin-4-yl(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)phosphoryl]morpholine (PubChem CID 10531889) has the molecular formula C16H18F15N2O4P and a molecular weight of 618.27 g/mol. Its IUPAC name is 4-[morpholin-4-yl(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)phosphoryl]morpholine.
| Compound Name | 4-[morpholin-4-yl(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)phosphoryl]morpholine |
|---|---|
| PubChem CID | 10531889 |
| Molecular Formula | C16H18F15N2O4P |
| Molecular Weight | 618.27 g/mol |
| Exact Mass | 618.08 |
| IUPAC Name | 4-[morpholin-4-yl(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)phosphoryl]morpholine |
| SMILES | O=P(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C16H18F15N2O4P/c17-10(18,9-37-38(34,32-1-5-35-6-2-32)33-3-7-36-8-4-33)11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)31/h1-9H2 |
| InChIKey | ILTDMPHESDTEFO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.27 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|