C42H49NO4 — CID 10532080
16-nonadecan-10-yl-15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-5-carboxylic acid (PubChem CID 10532080) has the molecular formula C42H49NO4 and a molecular weight of 631.86 g/mol. Its IUPAC name is 16-nonadecan-10-yl-15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-5-carboxylic acid.
| Compound Name | 16-nonadecan-10-yl-15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-5-carboxylic acid |
|---|---|
| PubChem CID | 10532080 |
| Molecular Formula | C42H49NO4 |
| Molecular Weight | 631.86 g/mol |
| Exact Mass | 631.37 |
| IUPAC Name | 16-nonadecan-10-yl-15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-5-carboxylic acid |
| SMILES | CCCCCCCCCC(CCCCCCCCC)N1C(=O)c2ccc3c4cccc5c(C(=O)O)ccc(c6ccc(c2c36)C1=O)c54 |
| InChI | InChI=1S/C42H49NO4/c1-3-5-7-9-11-13-15-18-28(19-16-14-12-10-8-6-4-2)43-40(44)35-26-23-32-29-20-17-21-30-34(42(46)47)25-22-31(37(29)30)33-24-27-36(41(43)45)39(35)38(32)33/h17,20-28H,3-16,18-19H2,1-2H3,(H,46,47) |
| InChIKey | XPBWEHSYVYUXBQ-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.86 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|