C33H44O12 — CID 10532090
(1S,3S,4R,5S,6R,7R)-6-[(E)-4,6-dimethyloct-2-enoyl]oxy-7-hydroxy-1-(4-hydroxy-5-methyl-3-methylidene-6-phenylhexyl)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid (PubChem CID 10532090) has the molecular formula C33H44O12 and a molecular weight of 632.70 g/mol. Its IUPAC name is (1S,3S,4R,5S,6R,7R)-6-[(E)-4,6-dimethyloct-2-enoyl]oxy-7-hydroxy-1-(4-hydroxy-5-methyl-3-methylidene-6-phenylhexyl)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid.
| Compound Name | (1S,3S,4R,5S,6R,7R)-6-[(E)-4,6-dimethyloct-2-enoyl]oxy-7-hydroxy-1-(4-hydroxy-5-methyl-3-methylidene-6-phenylhexyl)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
|---|---|
| PubChem CID | 10532090 |
| Molecular Formula | C33H44O12 |
| Molecular Weight | 632.70 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | (1S,3S,4R,5S,6R,7R)-6-[(E)-4,6-dimethyloct-2-enoyl]oxy-7-hydroxy-1-(4-hydroxy-5-methyl-3-methylidene-6-phenylhexyl)-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
| SMILES | C=C(CC[C@]12O[C@H](C(=O)O)[C@@H](C(=O)O)[C@](C(=O)O)(O1)[C@H](OC(=O)/C=C/C(C)CC(C)CC)[C@H]2O)C(O)C(C)Cc1ccccc1 |
| InChI | InChI=1S/C33H44O12/c1-6-18(2)16-19(3)12-13-23(34)43-28-27(36)32(15-14-20(4)25(35)21(5)17-22-10-8-7-9-11-22)44-26(30(39)40)24(29(37)38)33(28,45-32)31(41)42/h7-13,18-19,21,24-28,35-36H,4,6,14-17H2,1-3,5H3,(H,37,38)(H,39,40)(H,41,42)/b13-12+/t18?,19?,21?,24-,25?,26-,27+,28+,32-,33-/m0/s1 |
| InChIKey | BLYLLXAKVCZQCZ-SOIHKSQVSA-N |
| XLogP | 3.20 |
| TPSA | 197.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.70 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|