C8H14N2O2 — CID 105321671
[2-methoxy-1-(5-methylfuran-2-yl)ethyl]hydrazine (PubChem CID 105321671) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is [2-methoxy-1-(5-methylfuran-2-yl)ethyl]hydrazine.
| Compound Name | [2-methoxy-1-(5-methylfuran-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105321671 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | [2-methoxy-1-(5-methylfuran-2-yl)ethyl]hydrazine |
| SMILES | COCC(NN)c1ccc(C)o1 |
| InChI | InChI=1S/C8H14N2O2/c1-6-3-4-8(12-6)7(10-9)5-11-2/h3-4,7,10H,5,9H2,1-2H3 |
| InChIKey | GWVYOOCWGVTGEH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|