C10H15BrN2O2 — CID 105321682
[1-(2-bromo-5-methoxyphenyl)-2-methoxyethyl]hydrazine (PubChem CID 105321682) has the molecular formula C10H15BrN2O2 and a molecular weight of 275.15 g/mol. Its IUPAC name is [1-(2-bromo-5-methoxyphenyl)-2-methoxyethyl]hydrazine.
| Compound Name | [1-(2-bromo-5-methoxyphenyl)-2-methoxyethyl]hydrazine |
|---|---|
| PubChem CID | 105321682 |
| Molecular Formula | C10H15BrN2O2 |
| Molecular Weight | 275.15 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | [1-(2-bromo-5-methoxyphenyl)-2-methoxyethyl]hydrazine |
| SMILES | COCC(NN)c1cc(OC)ccc1Br |
| InChI | InChI=1S/C10H15BrN2O2/c1-14-6-10(13-12)8-5-7(15-2)3-4-9(8)11/h3-5,10,13H,6,12H2,1-2H3 |
| InChIKey | ADLGXQUYOJMCHQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.15 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|