C15H17BrFN3 — CID 105323075
4-[(5-bromo-2-fluorophenyl)-hydrazinylmethyl]-N,N-dimethylaniline (PubChem CID 105323075) has the molecular formula C15H17BrFN3 and a molecular weight of 338.22 g/mol. Its IUPAC name is 4-[(5-bromo-2-fluorophenyl)-hydrazinylmethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(5-bromo-2-fluorophenyl)-hydrazinylmethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 105323075 |
| Molecular Formula | C15H17BrFN3 |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 4-[(5-bromo-2-fluorophenyl)-hydrazinylmethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(NN)c2cc(Br)ccc2F)cc1 |
| InChI | InChI=1S/C15H17BrFN3/c1-20(2)12-6-3-10(4-7-12)15(19-18)13-9-11(16)5-8-14(13)17/h3-9,15,19H,18H2,1-2H3 |
| InChIKey | DLJRDGUMNPHSDK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|