C14H17ClF2N4 — CID 105323392
[1-(4-chloro-2,5-difluorophenyl)-2-(1-propylimidazol-2-yl)ethyl]hydrazine (PubChem CID 105323392) has the molecular formula C14H17ClF2N4 and a molecular weight of 314.77 g/mol. Its IUPAC name is [1-(4-chloro-2,5-difluorophenyl)-2-(1-propylimidazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(4-chloro-2,5-difluorophenyl)-2-(1-propylimidazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105323392 |
| Molecular Formula | C14H17ClF2N4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [1-(4-chloro-2,5-difluorophenyl)-2-(1-propylimidazol-2-yl)ethyl]hydrazine |
| SMILES | CCCn1ccnc1CC(NN)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C14H17ClF2N4/c1-2-4-21-5-3-19-14(21)8-13(20-18)9-6-12(17)10(15)7-11(9)16/h3,5-7,13,20H,2,4,8,18H2,1H3 |
| InChIKey | UUUIYOXZYCWOTF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|