C39H65N7O2 — CID 10532418
11-[5-[6-[8-[6-aminohexyl(methyl)amino]octyl-methylamino]hexylamino]pentanoyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one (PubChem CID 10532418) has the molecular formula C39H65N7O2 and a molecular weight of 664.00 g/mol. Its IUPAC name is 11-[5-[6-[8-[6-aminohexyl(methyl)amino]octyl-methylamino]hexylamino]pentanoyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one.
| Compound Name | 11-[5-[6-[8-[6-aminohexyl(methyl)amino]octyl-methylamino]hexylamino]pentanoyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 10532418 |
| Molecular Formula | C39H65N7O2 |
| Molecular Weight | 664.00 g/mol |
| Exact Mass | 663.52 |
| IUPAC Name | 11-[5-[6-[8-[6-aminohexyl(methyl)amino]octyl-methylamino]hexylamino]pentanoyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
| SMILES | CN(CCCCCCN)CCCCCCCCN(C)CCCCCCNCCCCC(=O)N1c2ccccc2C(=O)Nc2cccnc21 |
| InChI | InChI=1S/C39H65N7O2/c1-44(32-19-9-5-14-26-40)30-17-7-3-4-8-18-31-45(2)33-20-10-6-15-27-41-28-16-13-25-37(47)46-36-24-12-11-22-34(36)39(48)43-35-23-21-29-42-38(35)46/h11-12,21-24,29,41H,3-10,13-20,25-28,30-33,40H2,1-2H3,(H,43,48) |
| InChIKey | ACBSCMINIXTYQI-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.00 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|