C34H55N3O5Si3 — CID 10532469
(3R,4R,5S,6R)-3-azido-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-2-one (PubChem CID 10532469) has the molecular formula C34H55N3O5Si3 and a molecular weight of 670.09 g/mol. Its IUPAC name is (3R,4R,5S,6R)-3-azido-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-2-one.
| Compound Name | (3R,4R,5S,6R)-3-azido-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-2-one |
|---|---|
| PubChem CID | 10532469 |
| Molecular Formula | C34H55N3O5Si3 |
| Molecular Weight | 670.09 g/mol |
| Exact Mass | 669.34 |
| IUPAC Name | (3R,4R,5S,6R)-3-azido-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N=[N+]=[N-])C(=O)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H55N3O5Si3/c1-32(2,3)43(10,11)41-29-27(40-31(38)28(36-37-35)30(29)42-44(12,13)33(4,5)6)24-39-45(34(7,8)9,25-20-16-14-17-21-25)26-22-18-15-19-23-26/h14-23,27-30H,24H2,1-13H3/t27-,28-,29+,30-/m1/s1 |
| InChIKey | XPVCWULKICFVMF-GKIKGMKOSA-N |
| XLogP | 7.95 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.09 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|