C13H21FN2 — CID 105325387
[1-(3-fluoro-5-methylphenyl)-2,2-dimethylbutyl]hydrazine (PubChem CID 105325387) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is [1-(3-fluoro-5-methylphenyl)-2,2-dimethylbutyl]hydrazine.
| Compound Name | [1-(3-fluoro-5-methylphenyl)-2,2-dimethylbutyl]hydrazine |
|---|---|
| PubChem CID | 105325387 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | [1-(3-fluoro-5-methylphenyl)-2,2-dimethylbutyl]hydrazine |
| SMILES | CCC(C)(C)C(NN)c1cc(C)cc(F)c1 |
| InChI | InChI=1S/C13H21FN2/c1-5-13(3,4)12(16-15)10-6-9(2)7-11(14)8-10/h6-8,12,16H,5,15H2,1-4H3 |
| InChIKey | YMUHHWHLZSZNKM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|