C33H59NO6Si4 — CID 10532549
(3R,4S,5R)-6-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N-methyl-3,4,5-tris(trimethylsilyloxy)hexanamide (PubChem CID 10532549) has the molecular formula C33H59NO6Si4 and a molecular weight of 678.18 g/mol. Its IUPAC name is (3R,4S,5R)-6-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N-methyl-3,4,5-tris(trimethylsilyloxy)hexanamide.
| Compound Name | (3R,4S,5R)-6-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N-methyl-3,4,5-tris(trimethylsilyloxy)hexanamide |
|---|---|
| PubChem CID | 10532549 |
| Molecular Formula | C33H59NO6Si4 |
| Molecular Weight | 678.18 g/mol |
| Exact Mass | 677.34 |
| IUPAC Name | (3R,4S,5R)-6-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N-methyl-3,4,5-tris(trimethylsilyloxy)hexanamide |
| SMILES | CON(C)C(=O)C[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C33H59NO6Si4/c1-33(2,3)44(27-21-17-15-18-22-27,28-23-19-16-20-24-28)37-26-30(39-42(9,10)11)32(40-43(12,13)14)29(38-41(6,7)8)25-31(35)34(4)36-5/h15-24,29-30,32H,25-26H2,1-14H3/t29-,30-,32+/m1/s1 |
| InChIKey | CYDLYXNLPZEEHG-FUWNPBJGSA-N |
| XLogP | 6.63 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.18 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|