C43H40N8O — CID 10532613
2,7-diethyl-6-(methoxymethyl)-5-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrazolo[1,5-b][1,2,4]triazole (PubChem CID 10532613) has the molecular formula C43H40N8O and a molecular weight of 684.85 g/mol. Its IUPAC name is 2,7-diethyl-6-(methoxymethyl)-5-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrazolo[1,5-b][1,2,4]triazole.
| Compound Name | 2,7-diethyl-6-(methoxymethyl)-5-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrazolo[1,5-b][1,2,4]triazole |
|---|---|
| PubChem CID | 10532613 |
| Molecular Formula | C43H40N8O |
| Molecular Weight | 684.85 g/mol |
| Exact Mass | 684.33 |
| IUPAC Name | 2,7-diethyl-6-(methoxymethyl)-5-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrazolo[1,5-b][1,2,4]triazole |
| SMILES | CCc1nc2c(CC)c(COC)n(Cc3ccc(-c4ccccc4-c4nnnn4C(c4ccccc4)(c4ccccc4)c4ccccc4)cc3)n2n1 |
| InChI | InChI=1S/C43H40N8O/c1-4-36-39(30-52-3)49(51-41(36)44-40(5-2)46-51)29-31-25-27-32(28-26-31)37-23-15-16-24-38(37)42-45-47-48-50(42)43(33-17-9-6-10-18-33,34-19-11-7-12-20-34)35-21-13-8-14-22-35/h6-28H,4-5,29-30H2,1-3H3 |
| InChIKey | HKYAYVJTYQAFCN-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 87.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.85 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|