C13H27F3N2 — CID 105328893
(1,1,1-trifluoro-7,9,9-trimethyldecan-5-yl)hydrazine (PubChem CID 105328893) has the molecular formula C13H27F3N2 and a molecular weight of 268.37 g/mol. Its IUPAC name is (1,1,1-trifluoro-7,9,9-trimethyldecan-5-yl)hydrazine.
| Compound Name | (1,1,1-trifluoro-7,9,9-trimethyldecan-5-yl)hydrazine |
|---|---|
| PubChem CID | 105328893 |
| Molecular Formula | C13H27F3N2 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.21 |
| IUPAC Name | (1,1,1-trifluoro-7,9,9-trimethyldecan-5-yl)hydrazine |
| SMILES | CC(CC(CCCC(F)(F)F)NN)CC(C)(C)C |
| InChI | InChI=1S/C13H27F3N2/c1-10(9-12(2,3)4)8-11(18-17)6-5-7-13(14,15)16/h10-11,18H,5-9,17H2,1-4H3 |
| InChIKey | PKZBRFXWACTEAO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|