C10H19F3N2O2S — CID 105328934
[1-(1,1-dioxothiolan-3-yl)-6,6,6-trifluorohexan-2-yl]hydrazine (PubChem CID 105328934) has the molecular formula C10H19F3N2O2S and a molecular weight of 288.34 g/mol. Its IUPAC name is [1-(1,1-dioxothiolan-3-yl)-6,6,6-trifluorohexan-2-yl]hydrazine.
| Compound Name | [1-(1,1-dioxothiolan-3-yl)-6,6,6-trifluorohexan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105328934 |
| Molecular Formula | C10H19F3N2O2S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | [1-(1,1-dioxothiolan-3-yl)-6,6,6-trifluorohexan-2-yl]hydrazine |
| SMILES | NNC(CCCC(F)(F)F)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19F3N2O2S/c11-10(12,13)4-1-2-9(15-14)6-8-3-5-18(16,17)7-8/h8-9,15H,1-7,14H2 |
| InChIKey | KOUGUIYRWHBLHJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|