About [5,5,5-trifluoro-1-(5-methyloxolan-3-yl)pentyl]hydrazine
[5,5,5-trifluoro-1-(5-methyloxolan-3-yl)pentyl]hydrazine (PubChem CID 105329046) has the molecular formula C10H19F3N2O
and a molecular weight of 240.27 g/mol. Its IUPAC name is [5,5,5-trifluoro-1-(5-methyloxolan-3-yl)pentyl]hydrazine.
Molecular Properties
| Compound Name | [5,5,5-trifluoro-1-(5-methyloxolan-3-yl)pentyl]hydrazine |
| PubChem CID | 105329046 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [5,5,5-trifluoro-1-(5-methyloxolan-3-yl)pentyl]hydrazine |
| SMILES | CC1CC(C(CCCC(F)(F)F)NN)CO1 |
| InChI | InChI=1S/C10H19F3N2O/c1-7-5-8(6-16-7)9(15-14)3-2-4-10(11,12)13/h7-9,15H,2-6,14H2,1H3 |
| InChIKey | OKQNJBKJXQOSAX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5,5,5-trifluoro-1-(5-methyloxolan-3-yl)pentyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,5,5-trifluoro-1-(5-methyloxolan-3-yl)pentyl]hydrazine?
The IUPAC name of [5,5,5-trifluoro-1-(5-methyloxolan-3-yl)pentyl]hydrazine (CID 105329046) is [5,5,5-trifluoro-1-(5-methyloxolan-3-yl)pentyl]hydrazine.
What is the SMILES notation for [5,5,5-trifluoro-1-(5-methyloxolan-3-yl)pentyl]hydrazine?
The canonical SMILES for [5,5,5-trifluoro-1-(5-methyloxolan-3-yl)pentyl]hydrazine is CC1CC(C(CCCC(F)(F)F)NN)CO1.
What is the InChIKey of [5,5,5-trifluoro-1-(5-methyloxolan-3-yl)pentyl]hydrazine?
The InChIKey is OKQNJBKJXQOSAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N2O/c1-7-5-8(6-16-7)9(15-14)3-2-4-10(11,12)13/h7-9,15H,2-6,14H2,1H3.
What are the key properties of [5,5,5-trifluoro-1-(5-methyloxolan-3-yl)pentyl]hydrazine?
[5,5,5-trifluoro-1-(5-methyloxolan-3-yl)pentyl]hydrazine has a molecular weight of 240.27 g/mol, XLogP of 1.98, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5,5,5-trifluoro-1-(5-methyloxolan-3-yl)pentyl]hydrazine is sourced from PubChem (CID 105329046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).