C12H25F3N2 — CID 105329065
(1,1,1-trifluoro-7,8,8-trimethylnonan-5-yl)hydrazine (PubChem CID 105329065) has the molecular formula C12H25F3N2 and a molecular weight of 254.34 g/mol. Its IUPAC name is (1,1,1-trifluoro-7,8,8-trimethylnonan-5-yl)hydrazine.
| Compound Name | (1,1,1-trifluoro-7,8,8-trimethylnonan-5-yl)hydrazine |
|---|---|
| PubChem CID | 105329065 |
| Molecular Formula | C12H25F3N2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | (1,1,1-trifluoro-7,8,8-trimethylnonan-5-yl)hydrazine |
| SMILES | CC(CC(CCCC(F)(F)F)NN)C(C)(C)C |
| InChI | InChI=1S/C12H25F3N2/c1-9(11(2,3)4)8-10(17-16)6-5-7-12(13,14)15/h9-10,17H,5-8,16H2,1-4H3 |
| InChIKey | FYAFMTUVEAJOGD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|