C13H16BrN3OS — CID 105330543
[(3-bromothiophen-2-yl)-(5-propan-2-yloxy-3-pyridinyl)methyl]hydrazine (PubChem CID 105330543) has the molecular formula C13H16BrN3OS and a molecular weight of 342.26 g/mol. Its IUPAC name is [(3-bromothiophen-2-yl)-(5-propan-2-yloxy-3-pyridinyl)methyl]hydrazine.
| Compound Name | [(3-bromothiophen-2-yl)-(5-propan-2-yloxy-3-pyridinyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105330543 |
| Molecular Formula | C13H16BrN3OS |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | [(3-bromothiophen-2-yl)-(5-propan-2-yloxy-3-pyridinyl)methyl]hydrazine |
| SMILES | CC(C)Oc1cncc(C(NN)c2sccc2Br)c1 |
| InChI | InChI=1S/C13H16BrN3OS/c1-8(2)18-10-5-9(6-16-7-10)12(17-15)13-11(14)3-4-19-13/h3-8,12,17H,15H2,1-2H3 |
| InChIKey | KIODUSSVNJMECI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|