C14H24N2O — CID 105330649
[cycloheptyl-(2,5-dimethylfuran-3-yl)methyl]hydrazine (PubChem CID 105330649) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is [cycloheptyl-(2,5-dimethylfuran-3-yl)methyl]hydrazine.
| Compound Name | [cycloheptyl-(2,5-dimethylfuran-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105330649 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | [cycloheptyl-(2,5-dimethylfuran-3-yl)methyl]hydrazine |
| SMILES | Cc1cc(C(NN)C2CCCCCC2)c(C)o1 |
| InChI | InChI=1S/C14H24N2O/c1-10-9-13(11(2)17-10)14(16-15)12-7-5-3-4-6-8-12/h9,12,14,16H,3-8,15H2,1-2H3 |
| InChIKey | LSNRXZILTMKHHO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|