C38H57N3O6S3 — CID 10533085
N-ethyl-N-[4-[3-[ethyl-(2,4,6-trimethylphenyl)sulfonylamino]propyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 10533085) has the molecular formula C38H57N3O6S3 and a molecular weight of 748.09 g/mol. Its IUPAC name is N-ethyl-N-[4-[3-[ethyl-(2,4,6-trimethylphenyl)sulfonylamino]propyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-ethyl-N-[4-[3-[ethyl-(2,4,6-trimethylphenyl)sulfonylamino]propyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 10533085 |
| Molecular Formula | C38H57N3O6S3 |
| Molecular Weight | 748.09 g/mol |
| Exact Mass | 747.34 |
| IUPAC Name | N-ethyl-N-[4-[3-[ethyl-(2,4,6-trimethylphenyl)sulfonylamino]propyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | CCN(CCCCN(CCCN(CC)S(=O)(=O)c1c(C)cc(C)cc1C)S(=O)(=O)c1c(C)cc(C)cc1C)S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C38H57N3O6S3/c1-12-39(48(42,43)36-30(6)21-27(3)22-31(36)7)17-14-15-18-41(50(46,47)38-34(10)25-29(5)26-35(38)11)20-16-19-40(13-2)49(44,45)37-32(8)23-28(4)24-33(37)9/h21-26H,12-20H2,1-11H3 |
| InChIKey | QMFXPVKAUCXPNH-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.09 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|