C14H19F3N2O — CID 105330884
[(4,4-difluorocyclohexyl)-(5-fluoro-2-methoxyphenyl)methyl]hydrazine (PubChem CID 105330884) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is [(4,4-difluorocyclohexyl)-(5-fluoro-2-methoxyphenyl)methyl]hydrazine.
| Compound Name | [(4,4-difluorocyclohexyl)-(5-fluoro-2-methoxyphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105330884 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | [(4,4-difluorocyclohexyl)-(5-fluoro-2-methoxyphenyl)methyl]hydrazine |
| SMILES | COc1ccc(F)cc1C(NN)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H19F3N2O/c1-20-12-3-2-10(15)8-11(12)13(19-18)9-4-6-14(16,17)7-5-9/h2-3,8-9,13,19H,4-7,18H2,1H3 |
| InChIKey | WRIMNUMCDXOPRW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|