C34H26F12O2P2 — CID 10533132
bis[3,5-bis(trifluoromethyl)phenyl]-[(1S,2S)-2-diphenylphosphanyloxycyclohexyl]oxyphosphane (PubChem CID 10533132) has the molecular formula C34H26F12O2P2 and a molecular weight of 756.50 g/mol. Its IUPAC name is bis[3,5-bis(trifluoromethyl)phenyl]-[(1S,2S)-2-diphenylphosphanyloxycyclohexyl]oxyphosphane.
| Compound Name | bis[3,5-bis(trifluoromethyl)phenyl]-[(1S,2S)-2-diphenylphosphanyloxycyclohexyl]oxyphosphane |
|---|---|
| PubChem CID | 10533132 |
| Molecular Formula | C34H26F12O2P2 |
| Molecular Weight | 756.50 g/mol |
| Exact Mass | 756.12 |
| IUPAC Name | bis[3,5-bis(trifluoromethyl)phenyl]-[(1S,2S)-2-diphenylphosphanyloxycyclohexyl]oxyphosphane |
| SMILES | FC(F)(F)c1cc(P(O[C@H]2CCCC[C@@H]2OP(c2ccccc2)c2ccccc2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C34H26F12O2P2/c35-31(36,37)21-15-22(32(38,39)40)18-27(17-21)50(28-19-23(33(41,42)43)16-24(20-28)34(44,45)46)48-30-14-8-7-13-29(30)47-49(25-9-3-1-4-10-25)26-11-5-2-6-12-26/h1-6,9-12,15-20,29-30H,7-8,13-14H2/t29-,30-/m0/s1 |
| InChIKey | HBLDCYAMNSGKPR-KYJUHHDHSA-N |
| XLogP | 10.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.50 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|