C14H16BrN3 — CID 105333676
[1-(2-bromo-4-methylphenyl)-2-pyridin-3-ylethyl]hydrazine (PubChem CID 105333676) has the molecular formula C14H16BrN3 and a molecular weight of 306.21 g/mol. Its IUPAC name is [1-(2-bromo-4-methylphenyl)-2-pyridin-3-ylethyl]hydrazine.
| Compound Name | [1-(2-bromo-4-methylphenyl)-2-pyridin-3-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105333676 |
| Molecular Formula | C14H16BrN3 |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | [1-(2-bromo-4-methylphenyl)-2-pyridin-3-ylethyl]hydrazine |
| SMILES | Cc1ccc(C(Cc2cccnc2)NN)c(Br)c1 |
| InChI | InChI=1S/C14H16BrN3/c1-10-4-5-12(13(15)7-10)14(18-16)8-11-3-2-6-17-9-11/h2-7,9,14,18H,8,16H2,1H3 |
| InChIKey | VUJFCRLVOHJOKZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|