C40H79IO5Si2 — CID 10533475
(2S,3S,4S,5S,6R,8Z,10R,11S,12R,13Z)-14-iodo-3-(methoxymethoxy)-2,4,6,8,10,12-hexamethyl-5,11-bis[tri(propan-2-yl)silyloxy]tetradeca-8,13-dienal (PubChem CID 10533475) has the molecular formula C40H79IO5Si2 and a molecular weight of 823.14 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R,8Z,10R,11S,12R,13Z)-14-iodo-3-(methoxymethoxy)-2,4,6,8,10,12-hexamethyl-5,11-bis[tri(propan-2-yl)silyloxy]tetradeca-8,13-dienal.
| Compound Name | (2S,3S,4S,5S,6R,8Z,10R,11S,12R,13Z)-14-iodo-3-(methoxymethoxy)-2,4,6,8,10,12-hexamethyl-5,11-bis[tri(propan-2-yl)silyloxy]tetradeca-8,13-dienal |
|---|---|
| PubChem CID | 10533475 |
| Molecular Formula | C40H79IO5Si2 |
| Molecular Weight | 823.14 g/mol |
| Exact Mass | 822.45 |
| IUPAC Name | (2S,3S,4S,5S,6R,8Z,10R,11S,12R,13Z)-14-iodo-3-(methoxymethoxy)-2,4,6,8,10,12-hexamethyl-5,11-bis[tri(propan-2-yl)silyloxy]tetradeca-8,13-dienal |
| SMILES | COCO[C@@H]([C@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)C/C(C)=C\[C@@H](C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)/C=C\I)[C@H](C)C=O |
| InChI | InChI=1S/C40H79IO5Si2/c1-26(2)47(27(3)4,28(5)6)45-38(33(14)20-21-41)34(15)22-32(13)23-35(16)40(37(18)39(36(17)24-42)44-25-43-19)46-48(29(7)8,30(9)10)31(11)12/h20-22,24,26-31,33-40H,23,25H2,1-19H3/b21-20-,32-22-/t33-,34-,35-,36-,37+,38-,39-,40+/m1/s1 |
| InChIKey | LMALELZTOZHZFK-APNMCFSDSA-N |
| XLogP | 12.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.14 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|