C30H10F20O2P2 — CID 10533553
[(1S,2S)-2-bis(2,3,4,5,6-pentafluorophenyl)phosphanyloxycyclohexyl]oxy-bis(2,3,4,5,6-pentafluorophenyl)phosphane (PubChem CID 10533553) has the molecular formula C30H10F20O2P2 and a molecular weight of 844.32 g/mol. Its IUPAC name is [(1S,2S)-2-bis(2,3,4,5,6-pentafluorophenyl)phosphanyloxycyclohexyl]oxy-bis(2,3,4,5,6-pentafluorophenyl)phosphane.
| Compound Name | [(1S,2S)-2-bis(2,3,4,5,6-pentafluorophenyl)phosphanyloxycyclohexyl]oxy-bis(2,3,4,5,6-pentafluorophenyl)phosphane |
|---|---|
| PubChem CID | 10533553 |
| Molecular Formula | C30H10F20O2P2 |
| Molecular Weight | 844.32 g/mol |
| Exact Mass | 843.98 |
| IUPAC Name | [(1S,2S)-2-bis(2,3,4,5,6-pentafluorophenyl)phosphanyloxycyclohexyl]oxy-bis(2,3,4,5,6-pentafluorophenyl)phosphane |
| SMILES | Fc1c(F)c(F)c(P(O[C@H]2CCCC[C@@H]2OP(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C30H10F20O2P2/c31-7-11(35)19(43)27(20(44)12(7)36)53(28-21(45)13(37)8(32)14(38)22(28)46)51-5-3-1-2-4-6(5)52-54(29-23(47)15(39)9(33)16(40)24(29)48)30-25(49)17(41)10(34)18(42)26(30)50/h5-6H,1-4H2/t5-,6-/m0/s1 |
| InChIKey | SUZHYSYMDHYIHJ-WDSKDSINSA-N |
| XLogP | 9.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.32 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|