C56H48N4O2Zn — CID 10533672
zinc 2,3,5-trimethyl-6-[4-[10,15,20-tris(4-methylphenyl)porphyrin-22,24-diid-5-yl]cyclohexyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 10533672) has the molecular formula C56H48N4O2Zn and a molecular weight of 874.42 g/mol. Its IUPAC name is zinc 2,3,5-trimethyl-6-[4-[10,15,20-tris(4-methylphenyl)porphyrin-22,24-diid-5-yl]cyclohexyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | zinc 2,3,5-trimethyl-6-[4-[10,15,20-tris(4-methylphenyl)porphyrin-22,24-diid-5-yl]cyclohexyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 10533672 |
| Molecular Formula | C56H48N4O2Zn |
| Molecular Weight | 874.42 g/mol |
| Exact Mass | 872.31 |
| IUPAC Name | zinc 2,3,5-trimethyl-6-[4-[10,15,20-tris(4-methylphenyl)porphyrin-22,24-diid-5-yl]cyclohexyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(C2CCC(c3c4nc(c(-c5ccc(C)cc5)c5ccc([n-]5)c(-c5ccc(C)cc5)c5nc(c(-c6ccc(C)cc6)c6ccc3[n-]6)C=C5)C=C4)CC2)=C(C)C1=O.[Zn+2] |
| InChI | InChI=1S/C56H48N4O2.Zn/c1-31-7-13-38(14-8-31)51-42-23-25-44(57-42)52(39-15-9-32(2)10-16-39)46-27-29-48(59-46)54(41-21-19-37(20-22-41)50-36(6)55(61)34(4)35(5)56(50)62)49-30-28-47(60-49)53(45-26-24-43(51)58-45)40-17-11-33(3)12-18-40;/h7-18,23-30,37,41H,19-22H2,1-6H3;/q-2;+2/b51-42-,51-43-,52-44-,52-46-,53-45-,53-47-,54-48-,54-49-; |
| InChIKey | IAQINCAJQSOZNW-QTYWBUEGSA-N |
| XLogP | 12.92 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.42 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|