C13H21BrN6 — CID 105336938
[(4-bromo-1-propan-2-ylpyrazol-5-yl)-(3-ethyl-1-methylpyrazol-5-yl)methyl]hydrazine (PubChem CID 105336938) has the molecular formula C13H21BrN6 and a molecular weight of 341.26 g/mol. Its IUPAC name is [(4-bromo-1-propan-2-ylpyrazol-5-yl)-(3-ethyl-1-methylpyrazol-5-yl)methyl]hydrazine.
| Compound Name | [(4-bromo-1-propan-2-ylpyrazol-5-yl)-(3-ethyl-1-methylpyrazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105336938 |
| Molecular Formula | C13H21BrN6 |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | [(4-bromo-1-propan-2-ylpyrazol-5-yl)-(3-ethyl-1-methylpyrazol-5-yl)methyl]hydrazine |
| SMILES | CCc1cc(C(NN)c2c(Br)cnn2C(C)C)n(C)n1 |
| InChI | InChI=1S/C13H21BrN6/c1-5-9-6-11(19(4)18-9)12(17-15)13-10(14)7-16-20(13)8(2)3/h6-8,12,17H,5,15H2,1-4H3 |
| InChIKey | IPWYRMXOXBCPDH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|