C36H41N9O12S3 — CID 10533704
3,7,12-tris[(2-nitrophenyl)sulfonyl]-16-piperazin-1-yl-3,7,12,18-tetrazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene (PubChem CID 10533704) has the molecular formula C36H41N9O12S3 and a molecular weight of 887.98 g/mol. Its IUPAC name is 3,7,12-tris[(2-nitrophenyl)sulfonyl]-16-piperazin-1-yl-3,7,12,18-tetrazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene.
| Compound Name | 3,7,12-tris[(2-nitrophenyl)sulfonyl]-16-piperazin-1-yl-3,7,12,18-tetrazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene |
|---|---|
| PubChem CID | 10533704 |
| Molecular Formula | C36H41N9O12S3 |
| Molecular Weight | 887.98 g/mol |
| Exact Mass | 887.20 |
| IUPAC Name | 3,7,12-tris[(2-nitrophenyl)sulfonyl]-16-piperazin-1-yl-3,7,12,18-tetrazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)N1CCCCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])Cc2cc(N3CCNCC3)cc(n2)CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CCC1 |
| InChI | InChI=1S/C36H41N9O12S3/c46-43(47)31-10-1-4-13-34(31)58(52,53)40-18-7-8-19-41(59(54,55)35-14-5-2-11-32(35)44(48)49)26-28-24-30(39-22-16-37-17-23-39)25-29(38-28)27-42(21-9-20-40)60(56,57)36-15-6-3-12-33(36)45(50)51/h1-6,10-15,24-25,37H,7-9,16-23,26-27H2 |
| InChIKey | RRWSOPFQUCRSGV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 269.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.98 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|