C38H58N4O4+2 — CID 10533707
dibutyl-[3-[13-[3-[dibutyl(methyl)azaniumyl]propyl]-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]propyl]-methylazanium (PubChem CID 10533707) has the molecular formula C38H58N4O4+2 and a molecular weight of 634.91 g/mol. Its IUPAC name is dibutyl-[3-[13-[3-[dibutyl(methyl)azaniumyl]propyl]-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]propyl]-methylazanium.
| Compound Name | dibutyl-[3-[13-[3-[dibutyl(methyl)azaniumyl]propyl]-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]propyl]-methylazanium |
|---|---|
| PubChem CID | 10533707 |
| Molecular Formula | C38H58N4O4+2 |
| Molecular Weight | 634.91 g/mol |
| Exact Mass | 634.44 |
| IUPAC Name | dibutyl-[3-[13-[3-[dibutyl(methyl)azaniumyl]propyl]-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]propyl]-methylazanium |
| SMILES | CCCC[N+](C)(CCCC)CCCN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(CCC[N+](C)(CCCC)CCCC)C3=O |
| InChI | InChI=1S/C38H58N4O4/c1-7-11-23-41(5,24-12-8-2)27-15-21-39-35(43)29-17-19-31-34-32(20-18-30(33(29)34)36(39)44)38(46)40(37(31)45)22-16-28-42(6,25-13-9-3)26-14-10-4/h17-20H,7-16,21-28H2,1-6H3/q+2 |
| InChIKey | KFPQMHLJSXENIY-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.91 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|