C13H15BrCl2N4O — CID 105337278
[[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(2,4-dichlorophenyl)methyl]hydrazine (PubChem CID 105337278) has the molecular formula C13H15BrCl2N4O and a molecular weight of 394.10 g/mol. Its IUPAC name is [[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(2,4-dichlorophenyl)methyl]hydrazine.
| Compound Name | [[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(2,4-dichlorophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105337278 |
| Molecular Formula | C13H15BrCl2N4O |
| Molecular Weight | 394.10 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | [[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-(2,4-dichlorophenyl)methyl]hydrazine |
| SMILES | COCCn1ncc(Br)c1C(NN)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H15BrCl2N4O/c1-21-5-4-20-13(10(14)7-18-20)12(19-17)9-3-2-8(15)6-11(9)16/h2-3,6-7,12,19H,4-5,17H2,1H3 |
| InChIKey | CDPYNQIFPLVGCZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.10 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|