C12H21N3O2 — CID 105337951
[4-methoxy-1-(2-methoxy-3-pyridinyl)-2-methylbutyl]hydrazine (PubChem CID 105337951) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is [4-methoxy-1-(2-methoxy-3-pyridinyl)-2-methylbutyl]hydrazine.
| Compound Name | [4-methoxy-1-(2-methoxy-3-pyridinyl)-2-methylbutyl]hydrazine |
|---|---|
| PubChem CID | 105337951 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | [4-methoxy-1-(2-methoxy-3-pyridinyl)-2-methylbutyl]hydrazine |
| SMILES | COCCC(C)C(NN)c1cccnc1OC |
| InChI | InChI=1S/C12H21N3O2/c1-9(6-8-16-2)11(15-13)10-5-4-7-14-12(10)17-3/h4-5,7,9,11,15H,6,8,13H2,1-3H3 |
| InChIKey | USOQLCHQKNRJCE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|